C21H21N5O3S — CID 50994140
N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide (PubChem CID 50994140) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide.
| Compound Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 50994140 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[(2S)-1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-4-(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2noc(-c3cccs3)n2)cc1)C(=O)NCC#N |
| InChI | InChI=1S/C21H21N5O3S/c1-13(2)12-16(20(28)23-10-9-22)24-19(27)15-7-5-14(6-8-15)18-25-21(29-26-18)17-4-3-11-30-17/h3-8,11,13,16H,10,12H2,1-2H3,(H,23,28)(H,24,27)/t16-/m0/s1 |
| InChIKey | FCAAVWUXVKZIMW-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|