C16H25NO — CID 50994143
(2E,4E,6E)-1-pyrrolidin-1-yldodeca-2,4,6-trien-1-one (PubChem CID 50994143) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (2E,4E,6E)-1-pyrrolidin-1-yldodeca-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E)-1-pyrrolidin-1-yldodeca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 50994143 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (2E,4E,6E)-1-pyrrolidin-1-yldodeca-2,4,6-trien-1-one |
| SMILES | CCCCC/C=C/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H25NO/c1-2-3-4-5-6-7-8-9-10-13-16(18)17-14-11-12-15-17/h6-10,13H,2-5,11-12,14-15H2,1H3/b7-6+,9-8+,13-10+ |
| InChIKey | JWOSQNYJGWMFTO-NRWMFWRASA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|