C25H30N4O2 — CID 50994379
benzyl N-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)carbamate (PubChem CID 50994379) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is benzyl N-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)carbamate.
| Compound Name | benzyl N-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)carbamate |
|---|---|
| PubChem CID | 50994379 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | benzyl N-(2-cyclohexyl-6-pyrrolidin-1-yl-3H-benzimidazol-5-yl)carbamate |
| SMILES | O=C(Nc1cc2[nH]c(C3CCCCC3)nc2cc1N1CCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C25H30N4O2/c30-25(31-17-18-9-3-1-4-10-18)28-22-15-20-21(16-23(22)29-13-7-8-14-29)27-24(26-20)19-11-5-2-6-12-19/h1,3-4,9-10,15-16,19H,2,5-8,11-14,17H2,(H,26,27)(H,28,30) |
| InChIKey | ZGYVJIQNSGQUKA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |