C26H24BrNO6 — CID 50994691
(1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 50994691) has the molecular formula C26H24BrNO6 and a molecular weight of 526.38 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50994691 |
| Molecular Formula | C26H24BrNO6 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-3a-(4-bromophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)[C@@H](C(N)=O)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C26H24BrNO6/c1-32-17-12-18(33-2)22-19(13-17)34-26(15-8-10-16(27)11-9-15)21(14-6-4-3-5-7-14)20(24(28)30)23(29)25(22,26)31/h3-13,20-21,23,29,31H,1-2H3,(H2,28,30)/t20-,21-,23-,25+,26+/m1/s1 |
| InChIKey | ZEBOEZKXYLVFKW-VRFYTPIESA-N |
| XLogP | 3.20 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |