C19H18Cl3NO3 — CID 50994721
1-tert-butyl-2-(2,2,2-trichloroacetyl)-3,4-dihydro-1H-benzo[g]isoquinoline-5,10-dione (PubChem CID 50994721) has the molecular formula C19H18Cl3NO3 and a molecular weight of 414.72 g/mol. Its IUPAC name is 1-tert-butyl-2-(2,2,2-trichloroacetyl)-3,4-dihydro-1H-benzo[g]isoquinoline-5,10-dione.
| Compound Name | 1-tert-butyl-2-(2,2,2-trichloroacetyl)-3,4-dihydro-1H-benzo[g]isoquinoline-5,10-dione |
|---|---|
| PubChem CID | 50994721 |
| Molecular Formula | C19H18Cl3NO3 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1-tert-butyl-2-(2,2,2-trichloroacetyl)-3,4-dihydro-1H-benzo[g]isoquinoline-5,10-dione |
| SMILES | CC(C)(C)C1C2=C(CCN1C(=O)C(Cl)(Cl)Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18Cl3NO3/c1-18(2,3)16-13-12(8-9-23(16)17(26)19(20,21)22)14(24)10-6-4-5-7-11(10)15(13)25/h4-7,16H,8-9H2,1-3H3 |
| InChIKey | OTJYXJYBHLFGHG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|