C26H24BrNO5 — CID 50994763
N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide (PubChem CID 50994763) has the molecular formula C26H24BrNO5 and a molecular weight of 510.38 g/mol. Its IUPAC name is N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide.
| Compound Name | N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide |
|---|---|
| PubChem CID | 50994763 |
| Molecular Formula | C26H24BrNO5 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | N-[(1R,3S,3aR,8bS)-3a-(4-bromophenyl)-8b-hydroxy-6,8-dimethoxy-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]formamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)C[C@@H](NC=O)[C@@]21O |
| InChI | InChI=1S/C26H24BrNO5/c1-31-19-12-21(32-2)24-22(13-19)33-26(17-8-10-18(27)11-9-17)20(16-6-4-3-5-7-16)14-23(28-15-29)25(24,26)30/h3-13,15,20,23,30H,14H2,1-2H3,(H,28,29)/t20-,23+,25+,26-/m0/s1 |
| InChIKey | ACQKJOLZXIPBJP-HCBGRYSISA-N |
| XLogP | 4.24 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|