C25H24N2O3 — CID 50995047
(E)-3-[3-[5-[[3-(dimethylamino)benzoyl]amino]-2-methylphenyl]phenyl]prop-2-enoic acid (PubChem CID 50995047) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-3-[3-[5-[[3-(dimethylamino)benzoyl]amino]-2-methylphenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[5-[[3-(dimethylamino)benzoyl]amino]-2-methylphenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 50995047 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (E)-3-[3-[5-[[3-(dimethylamino)benzoyl]amino]-2-methylphenyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(NC(=O)c2cccc(N(C)C)c2)cc1-c1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C25H24N2O3/c1-17-10-12-21(26-25(30)20-8-5-9-22(15-20)27(2)3)16-23(17)19-7-4-6-18(14-19)11-13-24(28)29/h4-16H,1-3H3,(H,26,30)(H,28,29)/b13-11+ |
| InChIKey | GJFJZYZNAPYAMR-ACCUITESSA-N |
| XLogP | 5.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|