About 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine
1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine (PubChem CID 50995497) has the molecular formula C9H10ClF2NO
and a molecular weight of 221.63 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine |
| PubChem CID | 50995497 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine |
| SMILES | CONC(c1ccc(Cl)cc1)C(F)F |
| InChI | InChI=1S/C9H10ClF2NO/c1-14-13-8(9(11)12)6-2-4-7(10)5-3-6/h2-5,8-9,13H,1H3 |
| InChIKey | VFNNAYPYICDTNL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine?
The IUPAC name of 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine (CID 50995497) is 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine.
What is the SMILES notation for 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine?
The canonical SMILES for 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine is CONC(c1ccc(Cl)cc1)C(F)F.
What is the InChIKey of 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine?
The InChIKey is VFNNAYPYICDTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2NO/c1-14-13-8(9(11)12)6-2-4-7(10)5-3-6/h2-5,8-9,13H,1H3.
What are the key properties of 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine?
1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine has a molecular weight of 221.63 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,2-difluoro-N-methoxyethanamine is sourced from PubChem (CID 50995497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).