C15H14F2IN7O3S — CID 50995526
1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)urea (PubChem CID 50995526) has the molecular formula C15H14F2IN7O3S and a molecular weight of 537.29 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)urea.
| Compound Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 50995526 |
| Molecular Formula | C15H14F2IN7O3S |
| Molecular Weight | 537.29 g/mol |
| Exact Mass | 536.99 |
| IUPAC Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-(3-iodo-2H-pyrazolo[3,4-d]pyrimidin-4-yl)urea |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(NC(=O)Nc2ncnc3n[nH]c(I)c23)c1F |
| InChI | InChI=1S/C15H14F2IN7O3S/c1-2-5-29(27,28)25-8-4-3-7(16)11(10(8)17)21-15(26)22-13-9-12(18)23-24-14(9)20-6-19-13/h3-4,6,25H,2,5H2,1H3,(H3,19,20,21,22,23,24,26) |
| InChIKey | OQORIMJLRWTEBS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|