C18H21F2N7O5S — CID 50995892
1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-[3-(3-hydroxypropoxy)-1H-pyrazolo[5,4-d]pyrimidin-4-yl]urea (PubChem CID 50995892) has the molecular formula C18H21F2N7O5S and a molecular weight of 485.47 g/mol. Its IUPAC name is 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-[3-(3-hydroxypropoxy)-1H-pyrazolo[5,4-d]pyrimidin-4-yl]urea.
| Compound Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-[3-(3-hydroxypropoxy)-1H-pyrazolo[5,4-d]pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 50995892 |
| Molecular Formula | C18H21F2N7O5S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[2,6-difluoro-3-(propylsulfonylamino)phenyl]-3-[3-(3-hydroxypropoxy)-1H-pyrazolo[5,4-d]pyrimidin-4-yl]urea |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(NC(=O)Nc2ncnc3[nH]nc(OCCCO)c23)c1F |
| InChI | InChI=1S/C18H21F2N7O5S/c1-2-8-33(30,31)27-11-5-4-10(19)14(13(11)20)23-18(29)24-15-12-16(22-9-21-15)25-26-17(12)32-7-3-6-28/h4-5,9,27-28H,2-3,6-8H2,1H3,(H3,21,22,23,24,25,26,29) |
| InChIKey | CWQPEUMMDTUXEX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|