C33H31F5N4O2 — CID 50996330
(11R,13S,17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-[4-(2H-tetrazol-5-yl)phenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 50996330) has the molecular formula C33H31F5N4O2 and a molecular weight of 610.63 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-[4-(2H-tetrazol-5-yl)phenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-[4-(2H-tetrazol-5-yl)phenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 50996330 |
| Molecular Formula | C33H31F5N4O2 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-[4-(2H-tetrazol-5-yl)phenyl]phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(-c4ccc(-c5nn[nH]n5)cc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H31F5N4O2/c1-30-17-26(20-6-2-18(3-7-20)19-4-8-21(9-5-19)29-39-41-42-40-29)28-24-13-11-23(43)16-22(24)10-12-25(28)27(30)14-15-31(30,44)32(34,35)33(36,37)38/h2-9,16,25-27,44H,10-15,17H2,1H3,(H,39,40,41,42)/t25?,26-,27?,30+,31+/m1/s1 |
| InChIKey | DBCJSMZAFOIWNE-QWCDFDCRSA-N |
| XLogP | 7.36 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|