About methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate
methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 50996410) has the molecular formula C18H20N6O2
and a molecular weight of 352.40 g/mol. Its IUPAC name is methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| PubChem CID | 50996410 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(Nc2ncccc2-c2cnc3[nH]ccc3n2)CC1 |
| InChI | InChI=1S/C18H20N6O2/c1-26-18(25)24-9-5-12(6-10-24)22-16-13(3-2-7-19-16)15-11-21-17-14(23-15)4-8-20-17/h2-4,7-8,11-12H,5-6,9-10H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | SQPIIYGBMFSLFR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The IUPAC name of methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate (CID 50996410) is methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate.
What is the SMILES notation for methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The canonical SMILES for methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate is COC(=O)N1CCC(Nc2ncccc2-c2cnc3[nH]ccc3n2)CC1.
What is the InChIKey of methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate?
The InChIKey is SQPIIYGBMFSLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O2/c1-26-18(25)24-9-5-12(6-10-24)22-16-13(3-2-7-19-16)15-11-21-17-14(23-15)4-8-20-17/h2-4,7-8,11-12H,5-6,9-10H2,1H3,(H,19,22)(H,20,21).
What are the key properties of methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate?
methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate has a molecular weight of 352.40 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)-2-pyridinyl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 50996410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).