C30H22F7N5O2 — CID 50996814
butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate (PubChem CID 50996814) has the molecular formula C30H22F7N5O2 and a molecular weight of 617.53 g/mol. Its IUPAC name is butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate.
| Compound Name | butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 50996814 |
| Molecular Formula | C30H22F7N5O2 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | butyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate |
| SMILES | CCCCOC(=O)C(c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nn1)n1ccc2nc(-c3ccccc3F)nc-2c1 |
| InChI | InChI=1S/C30H22F7N5O2/c1-2-3-14-44-28(43)26(42-13-12-23-25(16-42)39-27(38-23)19-6-4-5-7-21(19)31)24-11-10-22(40-41-24)18-9-8-17(29(32,33)34)15-20(18)30(35,36)37/h4-13,15-16,26H,2-3,14H2,1H3 |
| InChIKey | OQADINITZSCGPF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|