C32H26F7N5O2 — CID 50996817
hexyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate (PubChem CID 50996817) has the molecular formula C32H26F7N5O2 and a molecular weight of 645.58 g/mol. Its IUPAC name is hexyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate.
| Compound Name | hexyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 50996817 |
| Molecular Formula | C32H26F7N5O2 |
| Molecular Weight | 645.58 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | hexyl 2-[6-[2,4-bis(trifluoromethyl)phenyl]pyridazin-3-yl]-2-[2-(2-fluorophenyl)imidazo[4,5-c]pyridin-5-yl]acetate |
| SMILES | CCCCCCOC(=O)C(c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nn1)n1ccc2nc(-c3ccccc3F)nc-2c1 |
| InChI | InChI=1S/C32H26F7N5O2/c1-2-3-4-7-16-46-30(45)28(44-15-14-25-27(18-44)41-29(40-25)21-8-5-6-9-23(21)33)26-13-12-24(42-43-26)20-11-10-19(31(34,35)36)17-22(20)32(37,38)39/h5-6,8-15,17-18,28H,2-4,7,16H2,1H3 |
| InChIKey | PXYITOODWKMFAZ-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.58 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|