C24H28BrNO4 — CID 5099714
oxolan-2-ylmethyl 4-(3-bromophenyl)-2,7,7-trimethyl-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxylate (PubChem CID 5099714) has the molecular formula C24H28BrNO4 and a molecular weight of 474.40 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-(3-bromophenyl)-2,7,7-trimethyl-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxylate.
| Compound Name | oxolan-2-ylmethyl 4-(3-bromophenyl)-2,7,7-trimethyl-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 5099714 |
| Molecular Formula | C24H28BrNO4 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | oxolan-2-ylmethyl 4-(3-bromophenyl)-2,7,7-trimethyl-5-oxo-1,4,4a,6-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OCC2CCCO2)C(c2cccc(Br)c2)C2C(=O)CC(C)(C)C=C2N1 |
| InChI | InChI=1S/C24H28BrNO4/c1-14-20(23(28)30-13-17-8-5-9-29-17)21(15-6-4-7-16(25)10-15)22-18(26-14)11-24(2,3)12-19(22)27/h4,6-7,10-11,17,21-22,26H,5,8-9,12-13H2,1-3H3 |
| InChIKey | HLXZCICIFWWXJU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |