C34H33F6NO4 — CID 50997206
[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl N-(4-fluorophenyl)carbamate (PubChem CID 50997206) has the molecular formula C34H33F6NO4 and a molecular weight of 633.63 g/mol. Its IUPAC name is [4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl N-(4-fluorophenyl)carbamate.
| Compound Name | [4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 50997206 |
| Molecular Formula | C34H33F6NO4 |
| Molecular Weight | 633.63 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | [4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl N-(4-fluorophenyl)carbamate |
| SMILES | C[C@]12C[C@H](c3ccc(COC(=O)Nc4ccc(F)cc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H33F6NO4/c1-31-17-27(20-4-2-19(3-5-20)18-45-30(43)41-23-9-7-22(35)8-10-23)29-25-13-11-24(42)16-21(25)6-12-26(29)28(31)14-15-32(31,44)33(36,37)34(38,39)40/h2-5,7-10,16,26-28,44H,6,11-15,17-18H2,1H3,(H,41,43)/t26?,27-,28?,31+,32+/m1/s1 |
| InChIKey | RKTMGQILVCDPNV-FMWKCXSCSA-N |
| XLogP | 8.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|