C30H33F5O2 — CID 50997576
(11R,13S,17S)-17-hydroxy-13-methyl-11-[3-(1-methylcyclopropyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 50997576) has the molecular formula C30H33F5O2 and a molecular weight of 520.58 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-11-[3-(1-methylcyclopropyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[3-(1-methylcyclopropyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 50997576 |
| Molecular Formula | C30H33F5O2 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[3-(1-methylcyclopropyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(c2cccc([C@H]3C[C@@]4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)c2)CC1 |
| InChI | InChI=1S/C30H33F5O2/c1-26(12-13-26)19-5-3-4-17(14-19)23-16-27(2)24(10-11-28(27,37)29(31,32)30(33,34)35)22-8-6-18-15-20(36)7-9-21(18)25(22)23/h3-5,14-15,22-24,37H,6-13,16H2,1-2H3/t22?,23-,24?,27+,28+/m1/s1 |
| InChIKey | BOKHZNWTOYFTOS-JJCJVZBMSA-N |
| XLogP | 7.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|