About 2-bromo-4,6-dimethylbenzenethiol
2-bromo-4,6-dimethylbenzenethiol (PubChem CID 50998034) has the molecular formula C8H9BrS
and a molecular weight of 217.13 g/mol. Its IUPAC name is 2-bromo-4,6-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2-bromo-4,6-dimethylbenzenethiol |
| PubChem CID | 50998034 |
| Molecular Formula | C8H9BrS |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 2-bromo-4,6-dimethylbenzenethiol |
| SMILES | Cc1cc(C)c(S)c(Br)c1 |
| InChI | InChI=1S/C8H9BrS/c1-5-3-6(2)8(10)7(9)4-5/h3-4,10H,1-2H3 |
| InChIKey | WVIWIHOYUHZRLD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4,6-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-dimethylbenzenethiol?
The IUPAC name of 2-bromo-4,6-dimethylbenzenethiol (CID 50998034) is 2-bromo-4,6-dimethylbenzenethiol.
What is the SMILES notation for 2-bromo-4,6-dimethylbenzenethiol?
The canonical SMILES for 2-bromo-4,6-dimethylbenzenethiol is Cc1cc(C)c(S)c(Br)c1.
What is the InChIKey of 2-bromo-4,6-dimethylbenzenethiol?
The InChIKey is WVIWIHOYUHZRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrS/c1-5-3-6(2)8(10)7(9)4-5/h3-4,10H,1-2H3.
What are the key properties of 2-bromo-4,6-dimethylbenzenethiol?
2-bromo-4,6-dimethylbenzenethiol has a molecular weight of 217.13 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-dimethylbenzenethiol is sourced from PubChem (CID 50998034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).