About 5-chloro-2,4-difluorobenzenethiol
5-chloro-2,4-difluorobenzenethiol (PubChem CID 50998076) has the molecular formula C6H3ClF2S
and a molecular weight of 180.61 g/mol. Its IUPAC name is 5-chloro-2,4-difluorobenzenethiol.
Molecular Properties
| Compound Name | 5-chloro-2,4-difluorobenzenethiol |
| PubChem CID | 50998076 |
| Molecular Formula | C6H3ClF2S |
| Molecular Weight | 180.61 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | 5-chloro-2,4-difluorobenzenethiol |
| SMILES | Fc1cc(F)c(Cl)cc1S |
| InChI | InChI=1S/C6H3ClF2S/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H |
| InChIKey | WNGWOEGJKYNQDC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,4-difluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4-difluorobenzenethiol?
The IUPAC name of 5-chloro-2,4-difluorobenzenethiol (CID 50998076) is 5-chloro-2,4-difluorobenzenethiol.
What is the SMILES notation for 5-chloro-2,4-difluorobenzenethiol?
The canonical SMILES for 5-chloro-2,4-difluorobenzenethiol is Fc1cc(F)c(Cl)cc1S.
What is the InChIKey of 5-chloro-2,4-difluorobenzenethiol?
The InChIKey is WNGWOEGJKYNQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClF2S/c7-3-1-6(10)5(9)2-4(3)8/h1-2,10H.
What are the key properties of 5-chloro-2,4-difluorobenzenethiol?
5-chloro-2,4-difluorobenzenethiol has a molecular weight of 180.61 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-difluorobenzenethiol is sourced from PubChem (CID 50998076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).