About 2,4-diethoxy-1,3-difluoro-5-iodobenzene
2,4-diethoxy-1,3-difluoro-5-iodobenzene (PubChem CID 50998226) has the molecular formula C10H11F2IO2
and a molecular weight of 328.10 g/mol. Its IUPAC name is 2,4-diethoxy-1,3-difluoro-5-iodobenzene.
Molecular Properties
| Compound Name | 2,4-diethoxy-1,3-difluoro-5-iodobenzene |
| PubChem CID | 50998226 |
| Molecular Formula | C10H11F2IO2 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2,4-diethoxy-1,3-difluoro-5-iodobenzene |
| SMILES | CCOc1c(F)cc(I)c(OCC)c1F |
| InChI | InChI=1S/C10H11F2IO2/c1-3-14-9-6(11)5-7(13)10(8(9)12)15-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | DJIZVWOCNLGXPK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethoxy-1,3-difluoro-5-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethoxy-1,3-difluoro-5-iodobenzene?
The IUPAC name of 2,4-diethoxy-1,3-difluoro-5-iodobenzene (CID 50998226) is 2,4-diethoxy-1,3-difluoro-5-iodobenzene.
What is the SMILES notation for 2,4-diethoxy-1,3-difluoro-5-iodobenzene?
The canonical SMILES for 2,4-diethoxy-1,3-difluoro-5-iodobenzene is CCOc1c(F)cc(I)c(OCC)c1F.
What is the InChIKey of 2,4-diethoxy-1,3-difluoro-5-iodobenzene?
The InChIKey is DJIZVWOCNLGXPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2IO2/c1-3-14-9-6(11)5-7(13)10(8(9)12)15-4-2/h5H,3-4H2,1-2H3.
What are the key properties of 2,4-diethoxy-1,3-difluoro-5-iodobenzene?
2,4-diethoxy-1,3-difluoro-5-iodobenzene has a molecular weight of 328.10 g/mol, XLogP of 3.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethoxy-1,3-difluoro-5-iodobenzene is sourced from PubChem (CID 50998226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).