About 2-bromo-1,4-difluoro-3-iodobenzene
2-bromo-1,4-difluoro-3-iodobenzene (PubChem CID 50998401) has the molecular formula C6H2BrF2I
and a molecular weight of 318.89 g/mol. Its IUPAC name is 2-bromo-1,4-difluoro-3-iodobenzene.
Molecular Properties
| Compound Name | 2-bromo-1,4-difluoro-3-iodobenzene |
| PubChem CID | 50998401 |
| Molecular Formula | C6H2BrF2I |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 317.84 |
| IUPAC Name | 2-bromo-1,4-difluoro-3-iodobenzene |
| SMILES | Fc1ccc(F)c(I)c1Br |
| InChI | InChI=1S/C6H2BrF2I/c7-5-3(8)1-2-4(9)6(5)10/h1-2H |
| InChIKey | NIPLHDTUPBKEOX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,4-difluoro-3-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,4-difluoro-3-iodobenzene?
The IUPAC name of 2-bromo-1,4-difluoro-3-iodobenzene (CID 50998401) is 2-bromo-1,4-difluoro-3-iodobenzene.
What is the SMILES notation for 2-bromo-1,4-difluoro-3-iodobenzene?
The canonical SMILES for 2-bromo-1,4-difluoro-3-iodobenzene is Fc1ccc(F)c(I)c1Br.
What is the InChIKey of 2-bromo-1,4-difluoro-3-iodobenzene?
The InChIKey is NIPLHDTUPBKEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrF2I/c7-5-3(8)1-2-4(9)6(5)10/h1-2H.
What are the key properties of 2-bromo-1,4-difluoro-3-iodobenzene?
2-bromo-1,4-difluoro-3-iodobenzene has a molecular weight of 318.89 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,4-difluoro-3-iodobenzene is sourced from PubChem (CID 50998401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).