About 2-deuterio-1,3-difluorobenzene
2-deuterio-1,3-difluorobenzene (PubChem CID 50998434) has the molecular formula C6H4F2
and a molecular weight of 115.10 g/mol. Its IUPAC name is 2-deuterio-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 2-deuterio-1,3-difluorobenzene |
| PubChem CID | 50998434 |
| Molecular Formula | C6H4F2 |
| Molecular Weight | 115.10 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 2-deuterio-1,3-difluorobenzene |
| SMILES | [2H]c1c(F)cccc1F |
| InChI | InChI=1S/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H/i4D |
| InChIKey | UEMGWPRHOOEKTA-QYKNYGDISA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.10 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-deuterio-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-1,3-difluorobenzene?
The IUPAC name of 2-deuterio-1,3-difluorobenzene (CID 50998434) is 2-deuterio-1,3-difluorobenzene.
What is the SMILES notation for 2-deuterio-1,3-difluorobenzene?
The canonical SMILES for 2-deuterio-1,3-difluorobenzene is [2H]c1c(F)cccc1F.
What is the InChIKey of 2-deuterio-1,3-difluorobenzene?
The InChIKey is UEMGWPRHOOEKTA-QYKNYGDISA-N. The full InChI is InChI=1S/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H/i4D.
What are the key properties of 2-deuterio-1,3-difluorobenzene?
2-deuterio-1,3-difluorobenzene has a molecular weight of 115.10 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-1,3-difluorobenzene is sourced from PubChem (CID 50998434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).