About 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride
3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride (PubChem CID 50998523) has the molecular formula C6H12ClN3O
and a molecular weight of 177.64 g/mol. Its IUPAC name is 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride |
| PubChem CID | 50998523 |
| Molecular Formula | C6H12ClN3O |
| Molecular Weight | 177.64 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride |
| SMILES | COc1nn(C)c(C)c1N.Cl |
| InChI | InChI=1S/C6H11N3O.ClH/c1-4-5(7)6(10-3)8-9(4)2;/h7H2,1-3H3;1H |
| InChIKey | LSVHEHXZCZMADY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.64 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride?
The IUPAC name of 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride (CID 50998523) is 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride.
What is the SMILES notation for 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride?
The canonical SMILES for 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride is COc1nn(C)c(C)c1N.Cl.
What is the InChIKey of 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride?
The InChIKey is LSVHEHXZCZMADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O.ClH/c1-4-5(7)6(10-3)8-9(4)2;/h7H2,1-3H3;1H.
What are the key properties of 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride?
3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride has a molecular weight of 177.64 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1,5-dimethylpyrazol-4-amine;hydrochloride is sourced from PubChem (CID 50998523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).