About 9-benzyl-6,8-diphenylpurine
9-benzyl-6,8-diphenylpurine (PubChem CID 50999032) has the molecular formula C24H18N4
and a molecular weight of 362.44 g/mol. Its IUPAC name is 9-benzyl-6,8-diphenylpurine.
Molecular Properties
| Compound Name | 9-benzyl-6,8-diphenylpurine |
| PubChem CID | 50999032 |
| Molecular Formula | C24H18N4 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 9-benzyl-6,8-diphenylpurine |
| SMILES | c1ccc(Cn2c(-c3ccccc3)nc3c(-c4ccccc4)ncnc32)cc1 |
| InChI | InChI=1S/C24H18N4/c1-4-10-18(11-5-1)16-28-23(20-14-8-3-9-15-20)27-22-21(25-17-26-24(22)28)19-12-6-2-7-13-19/h1-15,17H,16H2 |
| InChIKey | ZLYKOEJCSKSVEH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-benzyl-6,8-diphenylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-6,8-diphenylpurine?
The IUPAC name of 9-benzyl-6,8-diphenylpurine (CID 50999032) is 9-benzyl-6,8-diphenylpurine.
What is the SMILES notation for 9-benzyl-6,8-diphenylpurine?
The canonical SMILES for 9-benzyl-6,8-diphenylpurine is c1ccc(Cn2c(-c3ccccc3)nc3c(-c4ccccc4)ncnc32)cc1.
What is the InChIKey of 9-benzyl-6,8-diphenylpurine?
The InChIKey is ZLYKOEJCSKSVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4/c1-4-10-18(11-5-1)16-28-23(20-14-8-3-9-15-20)27-22-21(25-17-26-24(22)28)19-12-6-2-7-13-19/h1-15,17H,16H2.
What are the key properties of 9-benzyl-6,8-diphenylpurine?
9-benzyl-6,8-diphenylpurine has a molecular weight of 362.44 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-6,8-diphenylpurine is sourced from PubChem (CID 50999032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).