About 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine
4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine (PubChem CID 50999375) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 50999375 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine |
| SMILES | COc1nc(OC)c2cn[nH]c2n1 |
| InChI | InChI=1S/C7H8N4O2/c1-12-6-4-3-8-11-5(4)9-7(10-6)13-2/h3H,1-2H3,(H,8,9,10,11) |
| InChIKey | UTCPXICNROSCSK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine (CID 50999375) is 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine is COc1nc(OC)c2cn[nH]c2n1.
What is the InChIKey of 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine?
The InChIKey is UTCPXICNROSCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-12-6-4-3-8-11-5(4)9-7(10-6)13-2/h3H,1-2H3,(H,8,9,10,11).
What are the key properties of 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine?
4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine has a molecular weight of 180.17 g/mol, XLogP of 0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-1H-pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 50999375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).