About 2,3-dibromo-5,6-difluorobenzaldehyde
2,3-dibromo-5,6-difluorobenzaldehyde (PubChem CID 51000178) has the molecular formula C7H2Br2F2O
and a molecular weight of 299.90 g/mol. Its IUPAC name is 2,3-dibromo-5,6-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 2,3-dibromo-5,6-difluorobenzaldehyde |
| PubChem CID | 51000178 |
| Molecular Formula | C7H2Br2F2O |
| Molecular Weight | 299.90 g/mol |
| Exact Mass | 297.84 |
| IUPAC Name | 2,3-dibromo-5,6-difluorobenzaldehyde |
| SMILES | O=Cc1c(F)c(F)cc(Br)c1Br |
| InChI | InChI=1S/C7H2Br2F2O/c8-4-1-5(10)7(11)3(2-12)6(4)9/h1-2H |
| InChIKey | FSVOKYWVYDGMNB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-5,6-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-5,6-difluorobenzaldehyde?
The IUPAC name of 2,3-dibromo-5,6-difluorobenzaldehyde (CID 51000178) is 2,3-dibromo-5,6-difluorobenzaldehyde.
What is the SMILES notation for 2,3-dibromo-5,6-difluorobenzaldehyde?
The canonical SMILES for 2,3-dibromo-5,6-difluorobenzaldehyde is O=Cc1c(F)c(F)cc(Br)c1Br.
What is the InChIKey of 2,3-dibromo-5,6-difluorobenzaldehyde?
The InChIKey is FSVOKYWVYDGMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Br2F2O/c8-4-1-5(10)7(11)3(2-12)6(4)9/h1-2H.
What are the key properties of 2,3-dibromo-5,6-difluorobenzaldehyde?
2,3-dibromo-5,6-difluorobenzaldehyde has a molecular weight of 299.90 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-5,6-difluorobenzaldehyde is sourced from PubChem (CID 51000178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).