About 2,5-dibromo-3,6-difluorobenzoic acid
2,5-dibromo-3,6-difluorobenzoic acid (PubChem CID 51000180) has the molecular formula C7H2Br2F2O2
and a molecular weight of 315.90 g/mol. Its IUPAC name is 2,5-dibromo-3,6-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2,5-dibromo-3,6-difluorobenzoic acid |
| PubChem CID | 51000180 |
| Molecular Formula | C7H2Br2F2O2 |
| Molecular Weight | 315.90 g/mol |
| Exact Mass | 313.84 |
| IUPAC Name | 2,5-dibromo-3,6-difluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(Br)cc(F)c1Br |
| InChI | InChI=1S/C7H2Br2F2O2/c8-2-1-3(10)5(9)4(6(2)11)7(12)13/h1H,(H,12,13) |
| InChIKey | ADTKZZCYCASGJX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.90 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-3,6-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-3,6-difluorobenzoic acid?
The IUPAC name of 2,5-dibromo-3,6-difluorobenzoic acid (CID 51000180) is 2,5-dibromo-3,6-difluorobenzoic acid.
What is the SMILES notation for 2,5-dibromo-3,6-difluorobenzoic acid?
The canonical SMILES for 2,5-dibromo-3,6-difluorobenzoic acid is O=C(O)c1c(F)c(Br)cc(F)c1Br.
What is the InChIKey of 2,5-dibromo-3,6-difluorobenzoic acid?
The InChIKey is ADTKZZCYCASGJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Br2F2O2/c8-2-1-3(10)5(9)4(6(2)11)7(12)13/h1H,(H,12,13).
What are the key properties of 2,5-dibromo-3,6-difluorobenzoic acid?
2,5-dibromo-3,6-difluorobenzoic acid has a molecular weight of 315.90 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-3,6-difluorobenzoic acid is sourced from PubChem (CID 51000180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).