About 3-chloro-5-propan-2-yl-1,2,4-oxadiazole
3-chloro-5-propan-2-yl-1,2,4-oxadiazole (PubChem CID 51000283) has the molecular formula C5H7ClN2O
and a molecular weight of 146.58 g/mol. Its IUPAC name is 3-chloro-5-propan-2-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-chloro-5-propan-2-yl-1,2,4-oxadiazole |
| PubChem CID | 51000283 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 3-chloro-5-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1nc(Cl)no1 |
| InChI | InChI=1S/C5H7ClN2O/c1-3(2)4-7-5(6)8-9-4/h3H,1-2H3 |
| InChIKey | FFTIXTYCNSSYIA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-propan-2-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-propan-2-yl-1,2,4-oxadiazole?
The IUPAC name of 3-chloro-5-propan-2-yl-1,2,4-oxadiazole (CID 51000283) is 3-chloro-5-propan-2-yl-1,2,4-oxadiazole.
What is the SMILES notation for 3-chloro-5-propan-2-yl-1,2,4-oxadiazole?
The canonical SMILES for 3-chloro-5-propan-2-yl-1,2,4-oxadiazole is CC(C)c1nc(Cl)no1.
What is the InChIKey of 3-chloro-5-propan-2-yl-1,2,4-oxadiazole?
The InChIKey is FFTIXTYCNSSYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O/c1-3(2)4-7-5(6)8-9-4/h3H,1-2H3.
What are the key properties of 3-chloro-5-propan-2-yl-1,2,4-oxadiazole?
3-chloro-5-propan-2-yl-1,2,4-oxadiazole has a molecular weight of 146.58 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-propan-2-yl-1,2,4-oxadiazole is sourced from PubChem (CID 51000283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).