About 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine
2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine (PubChem CID 5100103) has the molecular formula C24H14F6N2O2
and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine.
Molecular Properties
| Compound Name | 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine |
| PubChem CID | 5100103 |
| Molecular Formula | C24H14F6N2O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine |
| SMILES | FC(F)(F)c1cccc(Oc2cc(Oc3cccc(C(F)(F)F)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H14F6N2O2/c25-23(26,27)16-8-4-10-18(12-16)33-20-14-21(32-22(31-20)15-6-2-1-3-7-15)34-19-11-5-9-17(13-19)24(28,29)30/h1-14H |
| InChIKey | VYAYYZBPSSNOII-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine?
The IUPAC name of 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine (CID 5100103) is 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine.
What is the SMILES notation for 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine?
The canonical SMILES for 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine is FC(F)(F)c1cccc(Oc2cc(Oc3cccc(C(F)(F)F)c3)nc(-c3ccccc3)n2)c1.
What is the InChIKey of 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine?
The InChIKey is VYAYYZBPSSNOII-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F6N2O2/c25-23(26,27)16-8-4-10-18(12-16)33-20-14-21(32-22(31-20)15-6-2-1-3-7-15)34-19-11-5-9-17(13-19)24(28,29)30/h1-14H.
What are the key properties of 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine?
2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine has a molecular weight of 476.38 g/mol, XLogP of 7.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4,6-bis[3-(trifluoromethyl)phenoxy]pyrimidine is sourced from PubChem (CID 5100103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).