C26H34N8O5S3 — CID 51001110
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 51001110) has the molecular formula C26H34N8O5S3 and a molecular weight of 634.81 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 51001110 |
| Molecular Formula | C26H34N8O5S3 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[(2-piperidin-4-yl-1,3-thiazol-4-yl)methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(C3CCNCC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C26H34N8O5S3/c27-26(28)30-9-2-5-21(25(36)37)33-23(35)22-20(8-12-40-22)34-42(38,39)19-4-1-3-17(13-19)31-14-18-15-41-24(32-18)16-6-10-29-11-7-16/h1,3-4,8,12-13,15-16,21,29,31,34H,2,5-7,9-11,14H2,(H,33,35)(H,36,37)(H4,27,28,30)/t21-/m0/s1 |
| InChIKey | OMHNFVNFQWQIBK-NRFANRHFSA-N |
| XLogP | 2.32 |
| TPSA | 213.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|