C30H41N9O6S3 — CID 51001189
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-morpholin-4-ylpiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 51001189) has the molecular formula C30H41N9O6S3 and a molecular weight of 719.92 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-morpholin-4-ylpiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-morpholin-4-ylpiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 51001189 |
| Molecular Formula | C30H41N9O6S3 |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-morpholin-4-ylpiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCC(N4CCOCC4)CC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C30H41N9O6S3/c31-29(32)33-9-2-5-25(28(41)42)36-27(40)26-24(8-16-46-26)37-48(43,44)23-4-1-3-20(17-23)34-18-21-19-47-30(35-21)39-10-6-22(7-11-39)38-12-14-45-15-13-38/h1,3-4,8,16-17,19,22,25,34,37H,2,5-7,9-15,18H2,(H,36,40)(H,41,42)(H4,31,32,33)/t25-/m0/s1 |
| InChIKey | HNDHFAHIPWQDKH-VWLOTQADSA-N |
| XLogP | 2.16 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|