C30H36N10O5S3 — CID 51001192
(2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 51001192) has the molecular formula C30H36N10O5S3 and a molecular weight of 712.88 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 51001192 |
| Molecular Formula | C30H36N10O5S3 |
| Molecular Weight | 712.88 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[3-[[3-[[2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCN(c4ccccn4)CC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C30H36N10O5S3/c31-29(32)34-11-4-7-24(28(42)43)37-27(41)26-23(9-16-46-26)38-48(44,45)22-6-3-5-20(17-22)35-18-21-19-47-30(36-21)40-14-12-39(13-15-40)25-8-1-2-10-33-25/h1-3,5-6,8-10,16-17,19,24,35,38H,4,7,11-15,18H2,(H,37,41)(H,42,43)(H4,31,32,34)/t24-/m0/s1 |
| InChIKey | FCJKYHJOWZJTFP-DEOSSOPVSA-N |
| XLogP | 2.58 |
| TPSA | 221.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|