C26H35N9O5S3 — CID 51001273
(2S)-2-[[3-[[3-[[2-(4-aminopiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 51001273) has the molecular formula C26H35N9O5S3 and a molecular weight of 649.83 g/mol. Its IUPAC name is (2S)-2-[[3-[[3-[[2-(4-aminopiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-[[3-[[2-(4-aminopiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 51001273 |
| Molecular Formula | C26H35N9O5S3 |
| Molecular Weight | 649.83 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | (2S)-2-[[3-[[3-[[2-(4-aminopiperidin-1-yl)-1,3-thiazol-4-yl]methylamino]phenyl]sulfonylamino]thiophene-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1sccc1NS(=O)(=O)c1cccc(NCc2csc(N3CCC(N)CC3)n2)c1)C(=O)O |
| InChI | InChI=1S/C26H35N9O5S3/c27-16-6-10-35(11-7-16)26-32-18(15-42-26)14-31-17-3-1-4-19(13-17)43(39,40)34-20-8-12-41-22(20)23(36)33-21(24(37)38)5-2-9-30-25(28)29/h1,3-4,8,12-13,15-16,21,31,34H,2,5-7,9-11,14,27H2,(H,33,36)(H,37,38)(H4,28,29,30)/t21-/m0/s1 |
| InChIKey | ASYHARPWRGTXLU-NRFANRHFSA-N |
| XLogP | 1.78 |
| TPSA | 231.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|