C23H23N5O2S — CID 51001515
N-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]benzenesulfonamide (PubChem CID 51001515) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is N-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51001515 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[3-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C2CCCN(c3ncnc4[nH]ccc34)C2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H23N5O2S/c29-31(30,20-9-2-1-3-10-20)27-19-8-4-6-17(14-19)18-7-5-13-28(15-18)23-21-11-12-24-22(21)25-16-26-23/h1-4,6,8-12,14,16,18,27H,5,7,13,15H2,(H,24,25,26) |
| InChIKey | AWPRCULMRSYBNG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |