About 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one
3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one (PubChem CID 51001937) has the molecular formula C27H18F2N2O2
and a molecular weight of 440.45 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one.
Molecular Properties
| Compound Name | 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one |
| PubChem CID | 51001937 |
| Molecular Formula | C27H18F2N2O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one |
| SMILES | O=C1C(c2cccnc2)=C(c2cc(F)cc(F)c2)c2ccc(OCCc3ccccn3)cc21 |
| InChI | InChI=1S/C27H18F2N2O2/c28-19-12-18(13-20(29)14-19)25-23-7-6-22(33-11-8-21-5-1-2-10-31-21)15-24(23)27(32)26(25)17-4-3-9-30-16-17/h1-7,9-10,12-16H,8,11H2 |
| InChIKey | KPGYRTVOWZXSHM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one?
The IUPAC name of 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one (CID 51001937) is 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one.
What is the SMILES notation for 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one?
The canonical SMILES for 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one is O=C1C(c2cccnc2)=C(c2cc(F)cc(F)c2)c2ccc(OCCc3ccccn3)cc21.
What is the InChIKey of 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one?
The InChIKey is KPGYRTVOWZXSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18F2N2O2/c28-19-12-18(13-20(29)14-19)25-23-7-6-22(33-11-8-21-5-1-2-10-31-21)15-24(23)27(32)26(25)17-4-3-9-30-16-17/h1-7,9-10,12-16H,8,11H2.
What are the key properties of 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one?
3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one has a molecular weight of 440.45 g/mol, XLogP of 5.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-difluorophenyl)-2-pyridin-3-yl-6-(2-pyridin-2-ylethoxy)inden-1-one is sourced from PubChem (CID 51001937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).