C28H42O3Si2 — CID 51002641
(2R,3R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-7-trimethylsilylhept-6-yne-2,4-diol (PubChem CID 51002641) has the molecular formula C28H42O3Si2 and a molecular weight of 482.81 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-7-trimethylsilylhept-6-yne-2,4-diol.
| Compound Name | (2R,3R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-7-trimethylsilylhept-6-yne-2,4-diol |
|---|---|
| PubChem CID | 51002641 |
| Molecular Formula | C28H42O3Si2 |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (2R,3R,4S,5S)-1-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethyl-7-trimethylsilylhept-6-yne-2,4-diol |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)C#C[Si](C)(C)C)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O3Si2/c1-22(19-20-32(6,7)8)27(30)23(2)26(29)21-31-33(28(3,4)5,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,22-23,26-27,29-30H,21H2,1-8H3/t22-,23-,26-,27-/m0/s1 |
| InChIKey | MKGOVWHPVZDFSW-ZCUSHOGSSA-N |
| XLogP | 4.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|