C13H24O3 — CID 51002643
[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxan-4-yl]methanol (PubChem CID 51002643) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is [(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 51002643 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxan-4-yl]methanol |
| SMILES | C=C(C)[C@H](C)[C@@H]1OC(C)(C)O[C@@H](CO)[C@@H]1C |
| InChI | InChI=1S/C13H24O3/c1-8(2)9(3)12-10(4)11(7-14)15-13(5,6)16-12/h9-12,14H,1,7H2,2-6H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | MLOMOXGTFVEPGT-BJDJZHNGSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|