C14H22O2 — CID 51002685
(4R,5R,6S)-4-ethynyl-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxane (PubChem CID 51002685) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4R,5R,6S)-4-ethynyl-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxane.
| Compound Name | (4R,5R,6S)-4-ethynyl-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 51002685 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4R,5R,6S)-4-ethynyl-2,2,5-trimethyl-6-[(2S)-3-methylbut-3-en-2-yl]-1,3-dioxane |
| SMILES | C#C[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)C(=C)C)[C@H]1C |
| InChI | InChI=1S/C14H22O2/c1-8-12-11(5)13(10(4)9(2)3)16-14(6,7)15-12/h1,10-13H,2H2,3-7H3/t10-,11-,12-,13-/m0/s1 |
| InChIKey | PLOHVSOCPYMGFC-CYDGBPFRSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|