C35H50O4Si — CID 51002731
methyl (2E,4S,5S)-2,4,6-trimethyl-5-[[(3S,4R)-3-methylundec-1-en-4-yl]oxy-diphenylsilyl]oxyhepta-2,6-dienoate (PubChem CID 51002731) has the molecular formula C35H50O4Si and a molecular weight of 562.87 g/mol. Its IUPAC name is methyl (2E,4S,5S)-2,4,6-trimethyl-5-[[(3S,4R)-3-methylundec-1-en-4-yl]oxy-diphenylsilyl]oxyhepta-2,6-dienoate.
| Compound Name | methyl (2E,4S,5S)-2,4,6-trimethyl-5-[[(3S,4R)-3-methylundec-1-en-4-yl]oxy-diphenylsilyl]oxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 51002731 |
| Molecular Formula | C35H50O4Si |
| Molecular Weight | 562.87 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | methyl (2E,4S,5S)-2,4,6-trimethyl-5-[[(3S,4R)-3-methylundec-1-en-4-yl]oxy-diphenylsilyl]oxyhepta-2,6-dienoate |
| SMILES | C=C[C@H](C)[C@@H](CCCCCCC)O[Si](O[C@H](C(=C)C)[C@@H](C)/C=C(\C)C(=O)OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H50O4Si/c1-9-11-12-13-20-25-33(28(5)10-2)38-40(31-21-16-14-17-22-31,32-23-18-15-19-24-32)39-34(27(3)4)29(6)26-30(7)35(36)37-8/h10,14-19,21-24,26,28-29,33-34H,2-3,9,11-13,20,25H2,1,4-8H3/b30-26+/t28-,29-,33+,34+/m0/s1 |
| InChIKey | HQNXPWGDQLAWAU-IACOPXDQSA-N |
| XLogP | 7.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.87 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|