C33H46O4Si — CID 51002732
methyl (E,4S)-4-[(4R,5S,6E,8S)-4-heptyl-5,7-dimethyl-2,2-diphenyl-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]-2-methylpent-2-enoate (PubChem CID 51002732) has the molecular formula C33H46O4Si and a molecular weight of 534.81 g/mol. Its IUPAC name is methyl (E,4S)-4-[(4R,5S,6E,8S)-4-heptyl-5,7-dimethyl-2,2-diphenyl-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]-2-methylpent-2-enoate.
| Compound Name | methyl (E,4S)-4-[(4R,5S,6E,8S)-4-heptyl-5,7-dimethyl-2,2-diphenyl-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 51002732 |
| Molecular Formula | C33H46O4Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | methyl (E,4S)-4-[(4R,5S,6E,8S)-4-heptyl-5,7-dimethyl-2,2-diphenyl-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]-2-methylpent-2-enoate |
| SMILES | CCCCCCC[C@H]1O[Si](c2ccccc2)(c2ccccc2)O[C@@H]([C@@H](C)/C=C(\C)C(=O)OC)/C(C)=C\[C@@H]1C |
| InChI | InChI=1S/C33H46O4Si/c1-7-8-9-10-17-22-31-25(2)23-26(3)32(27(4)24-28(5)33(34)35-6)37-38(36-31,29-18-13-11-14-19-29)30-20-15-12-16-21-30/h11-16,18-21,23-25,27,31-32H,7-10,17,22H2,1-6H3/b26-23-,28-24+/t25-,27-,31+,32+/m0/s1 |
| InChIKey | ZSZNYUCIMBHCBG-HFQGXWQASA-N |
| XLogP | 6.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|