About 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine
4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine (PubChem CID 51002786) has the molecular formula C21H18N2O2S
and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine |
| PubChem CID | 51002786 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3ccc4ccccc4c3)n2)cc1OC |
| InChI | InChI=1S/C21H18N2O2S/c1-24-19-10-8-16(12-20(19)25-2)18-13-26-21(23-18)22-17-9-7-14-5-3-4-6-15(14)11-17/h3-13H,1-2H3,(H,22,23) |
| InChIKey | UNXPLKKKOVRYFB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine (CID 51002786) is 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine is COc1ccc(-c2csc(Nc3ccc4ccccc4c3)n2)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine?
The InChIKey is UNXPLKKKOVRYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2S/c1-24-19-10-8-16(12-20(19)25-2)18-13-26-21(23-18)22-17-9-7-14-5-3-4-6-15(14)11-17/h3-13H,1-2H3,(H,22,23).
What are the key properties of 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine?
4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine has a molecular weight of 362.45 g/mol, XLogP of 5.72, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-N-naphthalen-2-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 51002786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).