C24H50N10 — CID 51003034
2,3,17,18-tetramethyl-1,4,7,10,13,16,19,22,25,28-decazacyclotriaconta-1,3,16,18-tetraene (PubChem CID 51003034) has the molecular formula C24H50N10 and a molecular weight of 478.73 g/mol. Its IUPAC name is 2,3,17,18-tetramethyl-1,4,7,10,13,16,19,22,25,28-decazacyclotriaconta-1,3,16,18-tetraene.
| Compound Name | 2,3,17,18-tetramethyl-1,4,7,10,13,16,19,22,25,28-decazacyclotriaconta-1,3,16,18-tetraene |
|---|---|
| PubChem CID | 51003034 |
| Molecular Formula | C24H50N10 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.42 |
| IUPAC Name | 2,3,17,18-tetramethyl-1,4,7,10,13,16,19,22,25,28-decazacyclotriaconta-1,3,16,18-tetraene |
| SMILES | CC1=N/CCNCCNCCNCC/N=C(C)/C(C)=N\CCNCCNCCNCC\N=C\1C |
| InChI | InChI=1S/C24H50N10/c1-21-22(2)32-18-14-28-10-6-26-8-12-30-16-20-34-24(4)23(3)33-19-15-29-11-7-25-5-9-27-13-17-31-21/h25-30H,5-20H2,1-4H3/b31-21-,32-22+,33-23+,34-24- |
| InChIKey | IDMGUEBLKWKCMQ-FYNGTMJJSA-N |
| XLogP | -0.62 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |