C20H36O3Si — CID 51003077
[(1S,4aR,6S,8aS)-5,5,8a-trimethyl-2-methylidene-6-trimethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate (PubChem CID 51003077) has the molecular formula C20H36O3Si and a molecular weight of 352.59 g/mol. Its IUPAC name is [(1S,4aR,6S,8aS)-5,5,8a-trimethyl-2-methylidene-6-trimethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,4aR,6S,8aS)-5,5,8a-trimethyl-2-methylidene-6-trimethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 51003077 |
| Molecular Formula | C20H36O3Si |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | [(1S,4aR,6S,8aS)-5,5,8a-trimethyl-2-methylidene-6-trimethylsilyloxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O[Si](C)(C)C)CC[C@]2(C)[C@H]1COC(C)=O |
| InChI | InChI=1S/C20H36O3Si/c1-14-9-10-17-19(3,4)18(23-24(6,7)8)11-12-20(17,5)16(14)13-22-15(2)21/h16-18H,1,9-13H2,2-8H3/t16-,17-,18-,20+/m0/s1 |
| InChIKey | JCPDSODGWHCVGF-CGBFIWBNSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|