C23H42O3Si — CID 51003078
[(1S,4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate (PubChem CID 51003078) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is [(1S,4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 51003078 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | [(1S,4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]1COC(C)=O |
| InChI | InChI=1S/C23H42O3Si/c1-16-11-12-19-22(6,7)20(26-27(9,10)21(3,4)5)13-14-23(19,8)18(16)15-25-17(2)24/h18-20H,1,11-15H2,2-10H3/t18-,19-,20-,23+/m0/s1 |
| InChIKey | QUQYRZIQWUGKBN-IHFIDZABSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|