C16H21NO7 — CID 51003090
ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 51003090) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51003090 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 5-[(2S,3S,4R)-3,4-diacetyloxyoxolan-2-yl]-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2OC[C@@H](OC(C)=O)[C@H]2OC(C)=O)[nH]c1C |
| InChI | InChI=1S/C16H21NO7/c1-5-21-16(20)11-6-12(17-8(11)2)14-15(24-10(4)19)13(7-22-14)23-9(3)18/h6,13-15,17H,5,7H2,1-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | PXZHTXMNBQEJPR-QLFBSQMISA-N |
| XLogP | 1.43 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|