C18H26N2O2 — CID 51003256
(2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(prop-2-enylamino)pent-4-enamide (PubChem CID 51003256) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(prop-2-enylamino)pent-4-enamide.
| Compound Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(prop-2-enylamino)pent-4-enamide |
|---|---|
| PubChem CID | 51003256 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-2-(prop-2-enylamino)pent-4-enamide |
| SMILES | C=CCN[C@@H](CC=C)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-10-16(19-13-6-2)18(22)20(4)14(3)17(21)15-11-8-7-9-12-15/h5-9,11-12,14,16-17,19,21H,1-2,10,13H2,3-4H3/t14-,16-,17+/m0/s1 |
| InChIKey | UQQMUBPSJZKVMT-BHYGNILZSA-N |
| XLogP | 2.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|