C23H27N5O3 — CID 51003435
N-[(2R,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(2-phenylethynyl)phenyl]piperazine-1-carboxamide (PubChem CID 51003435) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[(2R,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(2-phenylethynyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[(2R,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 51003435 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-[(2R,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
| SMILES | C[C@@H](N)[C@@H](NC(=O)N1CCN(c2ccc(C#Cc3ccccc3)cc2)CC1)C(=O)NO |
| InChI | InChI=1S/C23H27N5O3/c1-17(24)21(22(29)26-31)25-23(30)28-15-13-27(14-16-28)20-11-9-19(10-12-20)8-7-18-5-3-2-4-6-18/h2-6,9-12,17,21,31H,13-16,24H2,1H3,(H,25,30)(H,26,29)/t17-,21-/m1/s1 |
| InChIKey | VMHKUNCVQNGEJS-DYESRHJHSA-N |
| XLogP | 1.14 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|