C16H14N2O — CID 51003580
4-methyl-7-(2-phenylethynyl)-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 51003580) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-methyl-7-(2-phenylethynyl)-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 4-methyl-7-(2-phenylethynyl)-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 51003580 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-methyl-7-(2-phenylethynyl)-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | CN1CCOc2cc(C#Cc3ccccc3)cnc21 |
| InChI | InChI=1S/C16H14N2O/c1-18-9-10-19-15-11-14(12-17-16(15)18)8-7-13-5-3-2-4-6-13/h2-6,11-12H,9-10H2,1H3 |
| InChIKey | VUXRDOLWLFPPTE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|