C13H11N3OS — CID 51003592
6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine (PubChem CID 51003592) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 51003592 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 6-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(-c2ccc3nc(N)sc3c2)cn1 |
| InChI | InChI=1S/C13H11N3OS/c1-17-12-5-3-9(7-15-12)8-2-4-10-11(6-8)18-13(14)16-10/h2-7H,1H3,(H2,14,16) |
| InChIKey | CBBGVZCNBLEQID-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |