C16H17N3OS — CID 51003719
(E)-2-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 51003719) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is (E)-2-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51003719 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (E)-2-cyano-N-(4,5-dihydro-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C(\C#N)C(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C16H17N3OS/c1-11(2)13-5-3-12(4-6-13)9-14(10-17)15(20)19-16-18-7-8-21-16/h3-6,9,11H,7-8H2,1-2H3,(H,18,19,20)/b14-9+ |
| InChIKey | OOYLOZILAZZRIC-NTEUORMPSA-N |
| XLogP | 2.94 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|